Polymyxin B nonapeptide acetate
Referencia orb1296650-1mg
embalaje : 1mg
Marca : Biorbyt
Polymyxin B nonapeptide acetate
Catalog Number: orb1296650
Catalog Number | orb1296650 |
---|---|
Category | Small Molecules |
Description | Polymyxin B nonapeptide acetate |
Purity | 98.55% |
MW | 1023.19 |
SMILES | C[C@@H](O)[C@H]1C(NCC[C@H](NC([C@@H](NC([C@@H](N)[C@H](O)C)=O)CCN)=O)C(N[C@@H](CCN)C(N[C@H](CC2=CC=CC=C2)C(N[C@@H](CC(C)C)C(N[C@@H](CCN)C(N[C@@H](CCN)C(N1)=O)=O)=O)=O)=O)=O)=O.CC(O)=O |
Formula | C45H78N14O13 |
Biological Activity | Polymyxin B nonapeptide acetate is a cationic cyclic peptide. Polyxin B nonapeptide is a derivative produced by enzymatic cleavage of polyxin B. Compared with polyxin B, polyxin B nonapeptide has low toxicity, lacks bactericidal activity and still has the ability to destroy the outer membrane of Gram-negative bacteria. |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |